4-Bromo-4'-Chloro-1,1'-biphenyl, 99%
cas: 23055-77-8 — see every product listed under this CAS number, including other names
4-Bromo-4'-Chloro-1,1'-biphenyl, 99% (CAS 23055-77-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A180515-250mg |
| cas | 23055-77-8 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 125.62 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 203.50 Pln | |
| Ambeed | 10g | 281.38 Pln | |
| Ambeed | 25g | 592.88 Pln | |
| Ambeed | 100g | 2078.06 Pln | |
| BLDpharm | 250mg | 125.54 Pln | |
| BLDpharm | 1g | 136.64 Pln | |
| BLDpharm | 5g | 197.73 Pln | |
| BLDpharm | 10g | 297.70 Pln | |
| BLDpharm | 25g | 636.47 Pln | |
| BLDpharm | 100g | 2235.90 Pln |
properties
| purity | 99% |
|---|---|
| delivery time | 1-2 weeks |
1-bromo-4-(4-chlorophenyl)benzene (CAS 23055-77-8) is a chemical compound with the molecular formula C12H8BrCl and a molecular weight of 267.55 g/mol. IUPAC name: 1-bromo-4-(4-chlorophenyl)benzene. InChIKey: WMXVUHANYJZYHO-UHFFFAOYSA-N.
| Molecular formula | C12H8BrCl |
|---|---|
| Molecular weight | 267.55 g/mol |
| IUPAC name | 1-bromo-4-(4-chlorophenyl)benzene |
| InChIKey | WMXVUHANYJZYHO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)Br)Cl |
Computed by PubChem (NCBI)