CAS 91354-08-4 appears in our catalog under these names: 4-Bromo-3-chloro-1,1'-biphenyl 97%, 4-BROMO-3-CHLORO-1,1'-BIPHENYL, 98%, 4-Bromo-3-chloro-1,1'-biphenyl, 98%, 98%. Offered by: Ambeed, Fluorochem, Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100mg, 250mg.
1-bromo-2-chloro-4-phenylbenzene (CAS 91354-08-4) is a chemical compound with the molecular formula C12H8BrCl and a molecular weight of 267.55 g/mol. IUPAC name: 1-bromo-2-chloro-4-phenylbenzene. InChIKey: FWWAYVQEUCNZGP-UHFFFAOYSA-N.
| Molecular formula | C12H8BrCl |
|---|---|
| Molecular weight | 267.55 g/mol |
| IUPAC name | 1-bromo-2-chloro-4-phenylbenzene |
| InChIKey | FWWAYVQEUCNZGP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=C(C=C2)Br)Cl |
Computed by PubChem (NCBI)