CAS 39802-88-5 is the registry number for 4'-Bromo-2-chloro-1,1'-biphenyl, 98%, 98%. Offered by: Chemat. Available pack sizes: 1g, 5g.
1-bromo-4-(2-chlorophenyl)benzene (CAS 39802-88-5) is a chemical compound with the molecular formula C12H8BrCl and a molecular weight of 267.55 g/mol. IUPAC name: 1-bromo-4-(2-chlorophenyl)benzene. InChIKey: KHYAPLSEYCAKLD-UHFFFAOYSA-N.
| Molecular formula | C12H8BrCl |
|---|---|
| Molecular weight | 267.55 g/mol |
| IUPAC name | 1-bromo-4-(2-chlorophenyl)benzene |
| InChIKey | KHYAPLSEYCAKLD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=C(C=C2)Br)Cl |
Computed by PubChem (NCBI)