CAS 154407-17-7 appears in our catalog under these names: 2-Bromo-3'-chloro-1,1'-biphenyl, 95%, 2-Bromo-3'-chloro-1,1'-biphenyl 95%, 2-Bromo-3'-chloro-1,1'-biphenyl, 95%, 95%, 2-Bromo-3'-chloro-1,1'-biphenyl, 99%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 1g, 5g, 10g, 25g, 100g.
1-bromo-2-(3-chlorophenyl)benzene (CAS 154407-17-7) is a chemical compound with the molecular formula C12H8BrCl and a molecular weight of 267.55 g/mol. IUPAC name: 1-bromo-2-(3-chlorophenyl)benzene. InChIKey: CJBHNVDCKKHUFP-UHFFFAOYSA-N.
| Molecular formula | C12H8BrCl |
|---|---|
| Molecular weight | 267.55 g/mol |
| IUPAC name | 1-bromo-2-(3-chlorophenyl)benzene |
| InChIKey | CJBHNVDCKKHUFP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC(=CC=C2)Cl)Br |
Computed by PubChem (NCBI)