CAS 179526-95-5 appears in our catalog under these names: 2–Bromo–4'–chloro–1,1'–biphenyl, 2'-Bromo-4-chlorobiphenyl, >98.0%(GC), 2-Bromo-4'-chloro-1,1'-biphenyl 97%, 2-BROMO-4'-CHLOROBIPHENYL, 97%. Offered by: GLPBio, TCI, Ambeed, Fluorochem. Available pack sizes: 100g, 25g, 1g, 5g, 10g, 500g.
1-bromo-2-(4-chlorophenyl)benzene (CAS 179526-95-5) is a chemical compound with the molecular formula C12H8BrCl and a molecular weight of 267.55 g/mol. IUPAC name: 1-bromo-2-(4-chlorophenyl)benzene. InChIKey: WSHZWUXRWQVZQP-UHFFFAOYSA-N.
| Molecular formula | C12H8BrCl |
|---|---|
| Molecular weight | 267.55 g/mol |
| IUPAC name | 1-bromo-2-(4-chlorophenyl)benzene |
| InChIKey | WSHZWUXRWQVZQP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=C(C=C2)Cl)Br |
Computed by PubChem (NCBI)