cas: 58743-79-6 — see every product listed under this CAS number, including other names
4-Bromo-4'-ethyl-1,1'-biphenyl, 98% (CAS 58743-79-6) is a chemical reagent available from Chemat. Available pack sizes: 500g, 25g, 1g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A174449-500g |
| cas | 58743-79-6 |
| size | 500g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 500g | 4182.24 Pln | |
| AmBeed | 25g | 493.15 Pln | |
| AmBeed | 1g | 154.63 Pln | |
| AmBeed | 5g | 239.26 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
1-bromo-4-(4-ethylphenyl)benzene (CAS 58743-79-6) is a chemical compound with the molecular formula C14H13Br and a molecular weight of 261.16 g/mol. IUPAC name: 1-bromo-4-(4-ethylphenyl)benzene. InChIKey: OARBGVNQCYYPKT-UHFFFAOYSA-N.
| Molecular formula | C14H13Br |
|---|---|
| Molecular weight | 261.16 g/mol |
| IUPAC name | 1-bromo-4-(4-ethylphenyl)benzene |
| InChIKey | OARBGVNQCYYPKT-UHFFFAOYSA-N |
| SMILES | CCC1=CC=C(C=C1)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)