cas: 1784366-04-6 — see every product listed under this CAS number, including other names
4-Bromo-5-fluoro-2-hydroxybenzoic acid, 95% (CAS 1784366-04-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g. Offered by: AmBeed, Chemat, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A207065-5g |
| cas | 1784366-04-6 |
| size | 5g |
| availability | Synthetic Items: 0g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 8493.94 Pln | |
| Chemat | 100mg | 198.80 Pln | |
| Chemat | 250mg | 270.80 Pln | |
| Chemat | 1g | 510.80 Pln | |
| Fluorochem | 250mg | 362.39 Pln | |
| Fluorochem | 1g | 664.37 Pln | |
| Fluorochem | 5g | 2736.55 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
4-bromo-5-fluoro-2-hydroxybenzoic acid (CAS 1784366-04-6) is a chemical compound with the molecular formula C7H4BrFO3 and a molecular weight of 235.01 g/mol. IUPAC name: 4-bromo-5-fluoro-2-hydroxybenzoic acid. InChIKey: MNWUKSCLDBHHKU-UHFFFAOYSA-N.
| Molecular formula | C7H4BrFO3 |
|---|---|
| Molecular weight | 235.01 g/mol |
| IUPAC name | 4-bromo-5-fluoro-2-hydroxybenzoic acid |
| InChIKey | MNWUKSCLDBHHKU-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)Br)O)C(=O)O |
Computed by PubChem (NCBI)