CAS 1628539-98-9 is the registry number for 3-Bromo-4-fluoro-5-hydroxybenzoic acid, 98%. Offered by: AmBeed. Available pack sizes: 5g.
3-bromo-4-fluoro-5-hydroxybenzoic acid (CAS 1628539-98-9) is a chemical compound with the molecular formula C7H4BrFO3 and a molecular weight of 235.01 g/mol. IUPAC name: 3-bromo-4-fluoro-5-hydroxybenzoic acid. InChIKey: OYHGVXITAZUQIE-UHFFFAOYSA-N.
| Molecular formula | C7H4BrFO3 |
|---|---|
| Molecular weight | 235.01 g/mol |
| IUPAC name | 3-bromo-4-fluoro-5-hydroxybenzoic acid |
| InChIKey | OYHGVXITAZUQIE-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1O)F)Br)C(=O)O |
Computed by PubChem (NCBI)