CAS 2137924-38-8 is the registry number for 2-Bromo-3-fluoro-4,5-dihydroxybenzaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-3-fluoro-4,5-dihydroxybenzaldehyde (CAS 2137924-38-8) is a chemical compound with the molecular formula C7H4BrFO3 and a molecular weight of 235.01 g/mol. IUPAC name: 2-bromo-3-fluoro-4,5-dihydroxybenzaldehyde. InChIKey: CFVOKZNJAKFKDQ-UHFFFAOYSA-N.
| Molecular formula | C7H4BrFO3 |
|---|---|
| Molecular weight | 235.01 g/mol |
| IUPAC name | 2-bromo-3-fluoro-4,5-dihydroxybenzaldehyde |
| InChIKey | CFVOKZNJAKFKDQ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1O)O)F)Br)C=O |
Computed by PubChem (NCBI)