cas: 1623120-78-4 — see every product listed under this CAS number, including other names
4-Bromo-5-methoxy-2-nitro-benzoic acid methyl ester, 97%, 97% (CAS 1623120-78-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11AR8P-100mg |
| cas | 1623120-78-4 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 250mg | 150.80 Pln | |
| Chemat | 1g | 405.20 Pln | |
| Chemat | 5g | 1710.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Methyl 4-bromo-5-methoxy-2-nitrobenzoate (CAS 1623120-78-4) is a chemical compound with the molecular formula C9H8BrNO5 and a molecular weight of 290.07 g/mol. IUPAC name: methyl 4-bromo-5-methoxy-2-nitrobenzoate. InChIKey: HBRVKIMKZSYQHS-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNO5 |
|---|---|
| Molecular weight | 290.07 g/mol |
| IUPAC name | methyl 4-bromo-5-methoxy-2-nitrobenzoate |
| InChIKey | HBRVKIMKZSYQHS-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)C(=O)OC)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)