cas: 1623120-78-4 — see every product listed under this CAS number, including other names
METHYL 4-BROMO-5-METHOXY-2-NITROBENZOATE, 97% (CAS 1623120-78-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F499339-100MG |
| cas | 1623120-78-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 112.48 Pln | |
| Fluorochem | 250mg | 169.75 Pln | |
| Fluorochem | 1g | 513.38 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 4-bromo-5-methoxy-2-nitrobenzoate (CAS 1623120-78-4) is a chemical compound with the molecular formula C9H8BrNO5 and a molecular weight of 290.07 g/mol. IUPAC name: methyl 4-bromo-5-methoxy-2-nitrobenzoate. InChIKey: HBRVKIMKZSYQHS-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNO5 |
|---|---|
| Molecular weight | 290.07 g/mol |
| IUPAC name | methyl 4-bromo-5-methoxy-2-nitrobenzoate |
| InChIKey | HBRVKIMKZSYQHS-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)C(=O)OC)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)