cas: 740806-67-1 — see every product listed under this CAS number, including other names
4-Bromo-5-phenyloxazole, 98% (CAS 740806-67-1) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A127478-10g |
| cas | 740806-67-1 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 29267.35 Pln | |
| AmBeed | 5g | 15049.51 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
4-bromo-5-phenyl-1,3-oxazole (CAS 740806-67-1) is a chemical compound with the molecular formula C9H6BrNO and a molecular weight of 224.05 g/mol. IUPAC name: 4-bromo-5-phenyl-1,3-oxazole. InChIKey: BTLWIEARIJZPFS-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO |
|---|---|
| Molecular weight | 224.05 g/mol |
| IUPAC name | 4-bromo-5-phenyl-1,3-oxazole |
| InChIKey | BTLWIEARIJZPFS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(N=CO2)Br |
Computed by PubChem (NCBI)