CAS 740806-67-1 appears in our catalog under these names: 4-Bromo-5-phenyloxazole, 95%, 4-Bromo-5-phenyloxazole, 98%, 4-Bromo-5-phenyloxazole. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 10g, 100mg, 250mg, 5g.
4-bromo-5-phenyl-1,3-oxazole (CAS 740806-67-1) is a chemical compound with the molecular formula C9H6BrNO and a molecular weight of 224.05 g/mol. IUPAC name: 4-bromo-5-phenyl-1,3-oxazole. InChIKey: BTLWIEARIJZPFS-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO |
|---|---|
| Molecular weight | 224.05 g/mol |
| IUPAC name | 4-bromo-5-phenyl-1,3-oxazole |
| InChIKey | BTLWIEARIJZPFS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(N=CO2)Br |
Computed by PubChem (NCBI)