cas: 81945-13-3 — see every product listed under this CAS number, including other names
4-Bromo-7-hydroxy-2,3-dihydro-1H-inden-1-one, 96% (CAS 81945-13-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F228897-250MG |
| cas | 81945-13-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 159.34 Pln | |
| Fluorochem | 1g | 258.26 Pln | |
| Fluorochem | 5g | 919.49 Pln | |
| Fluorochem | 25g | 4298.50 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
4-bromo-7-hydroxy-2,3-dihydroinden-1-one (CAS 81945-13-3) is a chemical compound with the molecular formula C9H7BrO2 and a molecular weight of 227.05 g/mol. IUPAC name: 4-bromo-7-hydroxy-2,3-dihydroinden-1-one. InChIKey: ZTWBCFVYMDBPPD-UHFFFAOYSA-N.
| Molecular formula | C9H7BrO2 |
|---|---|
| Molecular weight | 227.05 g/mol |
| IUPAC name | 4-bromo-7-hydroxy-2,3-dihydroinden-1-one |
| InChIKey | ZTWBCFVYMDBPPD-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C(C=CC(=C21)Br)O |
Computed by PubChem (NCBI)