4-Bromo-7-hydroxy-2,3-dihydro-1H-inden-1-one, 96%
cas: 81945-13-3 — see every product listed under this CAS number, including other names
4-Bromo-7-hydroxy-2,3-dihydro-1H-inden-1-one, 96% (CAS 81945-13-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 100g, 25g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch114KZ8-100mg |
| cas | 81945-13-3 |
| size | 100mg |
| availability | 500g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 112.40 Pln | |
| Chemat | 1g | 227.60 Pln | |
| Chemat | 5g | 712.40 Pln | |
| Chemat | 100g | 10854.80 Pln | |
| Fluorochem | 250mg | 169.75 Pln | |
| Fluorochem | 1g | 279.09 Pln | |
| Fluorochem | 5g | 961.14 Pln | |
| Fluorochem | 25g | 4428.67 Pln |
properties
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
4-bromo-7-hydroxy-2,3-dihydroinden-1-one (CAS 81945-13-3) is a chemical compound with the molecular formula C9H7BrO2 and a molecular weight of 227.05 g/mol. IUPAC name: 4-bromo-7-hydroxy-2,3-dihydroinden-1-one. InChIKey: ZTWBCFVYMDBPPD-UHFFFAOYSA-N.
| Molecular formula | C9H7BrO2 |
|---|---|
| Molecular weight | 227.05 g/mol |
| IUPAC name | 4-bromo-7-hydroxy-2,3-dihydroinden-1-one |
| InChIKey | ZTWBCFVYMDBPPD-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C(C=CC(=C21)Br)O |
Computed by PubChem (NCBI)