CAS 1776-09-6 appears in our catalog under these names: 3-Bromo-3,4-dihydro-2h-1-benzopyran-4-one, 95%, 3-Bromochroman-4-one, 95-<97%, 3–broMo–2,3–dihydrochroMen–4–one, 3-BROMOCHROMAN-4-ONE, 95%. Offered by: Combi-blocks, Hoffman Fine Chemicals, GLPBio, Fluorochem. Available pack sizes: 250mg, 1g, 2,5g, 5g, 10g, 25g, 50g, 100mg.
3-bromo-2,3-dihydrochromen-4-one (CAS 1776-09-6) is a chemical compound with the molecular formula C9H7BrO2 and a molecular weight of 227.05 g/mol. IUPAC name: 3-bromo-2,3-dihydrochromen-4-one. InChIKey: FTRRZJIVFMSIJJ-UHFFFAOYSA-N.
| Molecular formula | C9H7BrO2 |
|---|---|
| Molecular weight | 227.05 g/mol |
| IUPAC name | 3-bromo-2,3-dihydrochromen-4-one |
| InChIKey | FTRRZJIVFMSIJJ-UHFFFAOYSA-N |
| SMILES | C1C(C(=O)C2=CC=CC=C2O1)Br |
Computed by PubChem (NCBI)