Products 81945-13-3
CAS 81945-13-3 appears in our catalog under these names: 4-Bromo-7-hydroxy-2,3-dihydro-1h-inden-1-one, 95%, 4-Bromo-7-hydroxy-2,3-dihydro-1H-inden-1-one 95%, 4-BROMO-7-HYDROXY-1-INDANONE, 97%, 4-Bromo-7-hydroxy-2,3-dihydro-1H-inden-1-one, 95%, 95%, 4-Bromo-7-hydroxy-2,3-dihydro-1H-inden-1-one, 96%. Offered by: Combi-blocks, Ambeed, Sigma-Aldrich, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100g, 100mg, 5g, 25g.
4-bromo-7-hydroxy-2,3-dihydroinden-1-one (CAS 81945-13-3) is a chemical compound with the molecular formula C9H7BrO2 and a molecular weight of 227.05 g/mol. IUPAC name: 4-bromo-7-hydroxy-2,3-dihydroinden-1-one. InChIKey: ZTWBCFVYMDBPPD-UHFFFAOYSA-N.
| Molecular formula | C9H7BrO2 |
|---|---|
| Molecular weight | 227.05 g/mol |
| IUPAC name | 4-bromo-7-hydroxy-2,3-dihydroinden-1-one |
| InChIKey | ZTWBCFVYMDBPPD-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C(C=CC(=C21)Br)O |
Computed by PubChem (NCBI)