CAS 63113-10-0 appears in our catalog under these names: 5-(Bromomethyl)-3H-2-benzofuran-1-one, 98%, 5-(Bromomethyl)isobenzofuran-1(3H)-one, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
5-(bromomethyl)-3H-2-benzofuran-1-one (CAS 63113-10-0) is a chemical compound with the molecular formula C9H7BrO2 and a molecular weight of 227.05 g/mol. IUPAC name: 5-(bromomethyl)-3H-2-benzofuran-1-one. InChIKey: IIAWAGJUKCOHRO-UHFFFAOYSA-N.
| Molecular formula | C9H7BrO2 |
|---|---|
| Molecular weight | 227.05 g/mol |
| IUPAC name | 5-(bromomethyl)-3H-2-benzofuran-1-one |
| InChIKey | IIAWAGJUKCOHRO-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC(=C2)CBr)C(=O)O1 |
Computed by PubChem (NCBI)