Products 168759-64-6
CAS 168759-64-6 appears in our catalog under these names: 7-Bromoisochroman-4-one, 95%, 7–Bromoisochroman–4–one, 7-Bromoisochroman-4-one, 7-Bromoisochroman-4-one 97%, 1H-2-Benzopyran-4(3H)-one, 7-bromo-, 97%, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg, 0,5g, 50mg, 500mg.
7-bromo-1H-isochromen-4-one (CAS 168759-64-6) is a chemical compound with the molecular formula C9H7BrO2 and a molecular weight of 227.05 g/mol. IUPAC name: 7-bromo-1H-isochromen-4-one. InChIKey: ASAGKWXSKFPRQW-UHFFFAOYSA-N.
| Molecular formula | C9H7BrO2 |
|---|---|
| Molecular weight | 227.05 g/mol |
| IUPAC name | 7-bromo-1H-isochromen-4-one |
| InChIKey | ASAGKWXSKFPRQW-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC(=C2)Br)C(=O)CO1 |
Computed by PubChem (NCBI)