cas: 347146-29-6 — see every product listed under this CAS number, including other names
4-Bromo-7-nitroisoquinoline 97% (CAS 347146-29-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A880292-100mg |
| cas | 347146-29-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 921.06 Pln | |
| Ambeed | 250mg | 1510.69 Pln | |
| Ambeed | 1g | 3702.31 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A880292 |
4-bromo-7-nitroisoquinoline (CAS 347146-29-6) is a chemical compound with the molecular formula C9H5BrN2O2 and a molecular weight of 253.05 g/mol. IUPAC name: 4-bromo-7-nitroisoquinoline. InChIKey: IBCREMOZTIARBM-UHFFFAOYSA-N.
| Molecular formula | C9H5BrN2O2 |
|---|---|
| Molecular weight | 253.05 g/mol |
| IUPAC name | 4-bromo-7-nitroisoquinoline |
| InChIKey | IBCREMOZTIARBM-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=NC=C2C=C1[N+](=O)[O-])Br |
Computed by PubChem (NCBI)