cas: 79606-46-5 — see every product listed under this CAS number, including other names
4-Bromo-N,N-bis(1-methylethyl)benzamide, 98%, 98% (CAS 79606-46-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116J0H-1g |
| cas | 79606-46-5 |
| size | 1g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 261.20 Pln | |
| Chemat | 5g | 654.80 Pln | |
| Chemat | 10g | 1101.20 Pln | |
| Chemat | 25g | 2138.00 Pln | |
| Chemat | 100g | 6707.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-bromo-N,N-di(propan-2-yl)benzamide (CAS 79606-46-5) is a chemical compound with the molecular formula C13H18BrNO and a molecular weight of 284.19 g/mol. IUPAC name: 4-bromo-N,N-di(propan-2-yl)benzamide. InChIKey: ZRHGXOKPARSBQA-UHFFFAOYSA-N.
| Molecular formula | C13H18BrNO |
|---|---|
| Molecular weight | 284.19 g/mol |
| IUPAC name | 4-bromo-N,N-di(propan-2-yl)benzamide |
| InChIKey | ZRHGXOKPARSBQA-UHFFFAOYSA-N |
| SMILES | CC(C)N(C(C)C)C(=O)C1=CC=C(C=C1)Br |
Computed by PubChem (NCBI)