cas: 90944-62-0 — see every product listed under this CAS number, including other names
4-Bromo-N,N-diethylbenzenesulfonamide 98% (CAS 90944-62-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A430935-250mg |
| cas | 90944-62-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 164.56 Pln | |
| Ambeed | 1g | 186.81 Pln | |
| Ambeed | 5g | 331.44 Pln | |
| Ambeed | 25g | 882.12 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A430935 |
4-bromo-N,N-diethylbenzenesulfonamide (CAS 90944-62-0) is a chemical compound with the molecular formula C10H14BrNO2S and a molecular weight of 292.19 g/mol. IUPAC name: 4-bromo-N,N-diethylbenzenesulfonamide. InChIKey: NRGTZJXYAAGKQJ-UHFFFAOYSA-N.
| Molecular formula | C10H14BrNO2S |
|---|---|
| Molecular weight | 292.19 g/mol |
| IUPAC name | 4-bromo-N,N-diethylbenzenesulfonamide |
| InChIKey | NRGTZJXYAAGKQJ-UHFFFAOYSA-N |
| SMILES | CCN(CC)S(=O)(=O)C1=CC=C(C=C1)Br |
Computed by PubChem (NCBI)