cas: 1055995-79-3 — see every product listed under this CAS number, including other names
4-Bromo-N-ethyl-3-fluorobenzene-1-sulfonamide 98% (CAS 1055995-79-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1041870-100mg |
| cas | 1055995-79-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 248.00 Pln | |
| Ambeed | 250mg | 353.69 Pln | |
| Ambeed | 1g | 776.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1041870 |
4-bromo-N-ethyl-3-fluorobenzenesulfonamide (CAS 1055995-79-3) is a chemical compound with the molecular formula C8H9BrFNO2S and a molecular weight of 282.13 g/mol. IUPAC name: 4-bromo-N-ethyl-3-fluorobenzenesulfonamide. InChIKey: JYKKBSXJXOBDNG-UHFFFAOYSA-N.
| Molecular formula | C8H9BrFNO2S |
|---|---|
| Molecular weight | 282.13 g/mol |
| IUPAC name | 4-bromo-N-ethyl-3-fluorobenzenesulfonamide |
| InChIKey | JYKKBSXJXOBDNG-UHFFFAOYSA-N |
| SMILES | CCNS(=O)(=O)C1=CC(=C(C=C1)Br)F |
Computed by PubChem (NCBI)