CAS 1865176-65-3 is the registry number for 5-Bromo-N-ethyl-2-fluorobenzenesulfonamide, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 25g.
5-bromo-N-ethyl-2-fluorobenzenesulfonamide (CAS 1865176-65-3) is a chemical compound with the molecular formula C8H9BrFNO2S and a molecular weight of 282.13 g/mol. IUPAC name: 5-bromo-N-ethyl-2-fluorobenzenesulfonamide. InChIKey: BIGPYZVUNVMPSY-UHFFFAOYSA-N.
| Molecular formula | C8H9BrFNO2S |
|---|---|
| Molecular weight | 282.13 g/mol |
| IUPAC name | 5-bromo-N-ethyl-2-fluorobenzenesulfonamide |
| InChIKey | BIGPYZVUNVMPSY-UHFFFAOYSA-N |
| SMILES | CCNS(=O)(=O)C1=C(C=CC(=C1)Br)F |
Computed by PubChem (NCBI)