CAS 871353-11-6 is the registry number for 3-Bromo-2-fluoro-n,n-dimethyl-benzenesulfonamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-bromo-2-fluoro-N,N-dimethylbenzenesulfonamide (CAS 871353-11-6) is a chemical compound with the molecular formula C8H9BrFNO2S and a molecular weight of 282.13 g/mol. IUPAC name: 3-bromo-2-fluoro-N,N-dimethylbenzenesulfonamide. InChIKey: XTUVPJKPURSDOP-UHFFFAOYSA-N.
| Molecular formula | C8H9BrFNO2S |
|---|---|
| Molecular weight | 282.13 g/mol |
| IUPAC name | 3-bromo-2-fluoro-N,N-dimethylbenzenesulfonamide |
| InChIKey | XTUVPJKPURSDOP-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=C(C(=CC=C1)Br)F |
Computed by PubChem (NCBI)