CAS 1387887-66-2 is the registry number for 5-Bromo-2-fluoro-N,N-dimethylbenzenesulfonamide, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 250mg.
5-bromo-2-fluoro-N,N-dimethylbenzenesulfonamide (CAS 1387887-66-2) is a chemical compound with the molecular formula C8H9BrFNO2S and a molecular weight of 282.13 g/mol. IUPAC name: 5-bromo-2-fluoro-N,N-dimethylbenzenesulfonamide. InChIKey: QPLSZRHQPKYSLB-UHFFFAOYSA-N.
| Molecular formula | C8H9BrFNO2S |
|---|---|
| Molecular weight | 282.13 g/mol |
| IUPAC name | 5-bromo-2-fluoro-N,N-dimethylbenzenesulfonamide |
| InChIKey | QPLSZRHQPKYSLB-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=C(C=CC(=C1)Br)F |
Computed by PubChem (NCBI)