CAS 779331-34-9 is the registry number for 4-Bromo-3-fluoro-N,N-dimethylbenzenesulfonamide, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
4-bromo-3-fluoro-N,N-dimethylbenzenesulfonamide (CAS 779331-34-9) is a chemical compound with the molecular formula C8H9BrFNO2S and a molecular weight of 282.13 g/mol. IUPAC name: 4-bromo-3-fluoro-N,N-dimethylbenzenesulfonamide. InChIKey: HXXQGQQYIIUQHY-UHFFFAOYSA-N.
| Molecular formula | C8H9BrFNO2S |
|---|---|
| Molecular weight | 282.13 g/mol |
| IUPAC name | 4-bromo-3-fluoro-N,N-dimethylbenzenesulfonamide |
| InChIKey | HXXQGQQYIIUQHY-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=CC(=C(C=C1)Br)F |
Computed by PubChem (NCBI)