cas: 29203-58-5 — see every product listed under this CAS number, including other names
4-Bromo-N-hydroxybenzenecarboximidoyl chloride, 97%, 97% (CAS 29203-58-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113XO3-100mg |
| cas | 29203-58-5 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 198.80 Pln | |
| Chemat | 250mg | 270.80 Pln | |
| Chemat | 1g | 506.00 Pln | |
| Chemat | 5g | 1442.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(1Z)-4-bromo-N-hydroxybenzenecarboximidoyl chloride (CAS 29203-58-5) is a chemical compound with the molecular formula C7H5BrClNO and a molecular weight of 234.48 g/mol. IUPAC name: (1Z)-4-bromo-N-hydroxybenzenecarboximidoyl chloride. InChIKey: ZOPFQZFNZNMZEF-YFHOEESVSA-N.
| Molecular formula | C7H5BrClNO |
|---|---|
| Molecular weight | 234.48 g/mol |
| IUPAC name | (1Z)-4-bromo-N-hydroxybenzenecarboximidoyl chloride |
| InChIKey | ZOPFQZFNZNMZEF-YFHOEESVSA-N |
| SMILES | C1=CC(=CC=C1/C(=N/O)/Cl)Br |
Computed by PubChem (NCBI)