cas: 1732-26-9 — see every product listed under this CAS number, including other names
4-Bromopyrene, >95.0%(GC) (CAS 1732-26-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | B2807-1G |
| cas | 1732-26-9 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 1234.56 Pln | |
| TCI | 5g | 4298.01 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >95.0%(GC) |
4-bromopyrene (CAS 1732-26-9) is a chemical compound with the molecular formula C16H9Br and a molecular weight of 281.15 g/mol. IUPAC name: 4-bromopyrene. InChIKey: QMHTZTOPYZKQLC-UHFFFAOYSA-N.
| Molecular formula | C16H9Br |
|---|---|
| Molecular weight | 281.15 g/mol |
| IUPAC name | 4-bromopyrene |
| InChIKey | QMHTZTOPYZKQLC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=C1)C=C(C4=CC=CC(=C43)C=C2)Br |
Computed by PubChem (NCBI)