CAS 1714-27-8 appears in our catalog under these names: 2-Bromopyrene, 95%, 2-Bromopyrene, 97%, 97%, 2-Bromopyrene, 97%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 1g, 100mg, 250mg.
2-bromopyrene (CAS 1714-27-8) is a chemical compound with the molecular formula C16H9Br and a molecular weight of 281.15 g/mol. IUPAC name: 2-bromopyrene. InChIKey: FQVOKXARZCJTIT-UHFFFAOYSA-N.
| Molecular formula | C16H9Br |
|---|---|
| Molecular weight | 281.15 g/mol |
| IUPAC name | 2-bromopyrene |
| InChIKey | FQVOKXARZCJTIT-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=C1)C=CC4=C3C(=CC(=C4)Br)C=C2 |
Computed by PubChem (NCBI)