CAS 1732-26-9 appears in our catalog under these names: 4-Bromopyrene, 95%, 4-Bromopyrene, 4–Bromopyrene, 4-Bromopyrene, >95.0%(GC), 4-Bromopyrene, 95%, 95%. Offered by: Combi-blocks, TRC, GLPBio, TCI, Chemat. Available pack sizes: 250mg, 1g, 10mg, 25mg, 5g, 50mg, 100mg, 10g.
4-bromopyrene (CAS 1732-26-9) is a chemical compound with the molecular formula C16H9Br and a molecular weight of 281.15 g/mol. IUPAC name: 4-bromopyrene. InChIKey: QMHTZTOPYZKQLC-UHFFFAOYSA-N.
| Molecular formula | C16H9Br |
|---|---|
| Molecular weight | 281.15 g/mol |
| IUPAC name | 4-bromopyrene |
| InChIKey | QMHTZTOPYZKQLC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=C1)C=C(C4=CC=CC(=C43)C=C2)Br |
Computed by PubChem (NCBI)