CAS 13438-50-1 appears in our catalog under these names: 3-Bromofluoranthene, 98%, 3-Bromofluoranthene, >95% (HPLC), 3–Bromofluoranthene, 3-Bromofluoranthene, >98.0%(GC), 3-BROMOFLUORANTHENE, 95%, 95%. Offered by: Combi-blocks, TRC, GLPBio, TCI, Chemat. Available pack sizes: 1g, 10g, 5g, 25g, 2,5mg, 5mg, 100g, 500g.
3-bromofluoranthene (CAS 13438-50-1) is a chemical compound with the molecular formula C16H9Br and a molecular weight of 281.15 g/mol. IUPAC name: 3-bromofluoranthene. InChIKey: WCXFCLXZMIFHBU-UHFFFAOYSA-N.
| Molecular formula | C16H9Br |
|---|---|
| Molecular weight | 281.15 g/mol |
| IUPAC name | 3-bromofluoranthene |
| InChIKey | WCXFCLXZMIFHBU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C4C2=CC=CC4=C(C=C3)Br |
Computed by PubChem (NCBI)