CAS 1714-29-0 appears in our catalog under these names: 1-Bromopyrene, >95% (HPLC), 1–Bromopyrene, 1-Bromopyrene, 95% , 1-Bromopyrene, 1-Bromopyrene, >95.0%(GC). Offered by: TRC, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, TCI. Available pack sizes: 1g, 100g, 25g, 500g, 5g, 10g, 1000g, 50g.
1-bromopyrene (CAS 1714-29-0) is a chemical compound with the molecular formula C16H9Br and a molecular weight of 281.15 g/mol. IUPAC name: 1-bromopyrene. InChIKey: HYGLETVERPVXOS-UHFFFAOYSA-N.
| Molecular formula | C16H9Br |
|---|---|
| Molecular weight | 281.15 g/mol |
| IUPAC name | 1-bromopyrene |
| InChIKey | HYGLETVERPVXOS-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=C1)C=CC4=C(C=CC(=C43)C=C2)Br |
Computed by PubChem (NCBI)