cas: 82703-38-6 — see every product listed under this CAS number, including other names
4-CHLORO-5,6-DIMETHYL-7H-PYRROLO[2,3-D]PYRIMIDINE, 98% (CAS 82703-38-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F505448-100MG |
| cas | 82703-38-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1997.23 Pln | |
| Fluorochem | 250mg | 3340.51 Pln | |
| Fluorochem | 1g | 8468.91 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
4-chloro-5,6-dimethyl-7H-pyrrolo[2,3-d]pyrimidine (CAS 82703-38-6) is a chemical compound with the molecular formula C8H8ClN3 and a molecular weight of 181.62 g/mol. IUPAC name: 4-chloro-5,6-dimethyl-7H-pyrrolo[2,3-d]pyrimidine. InChIKey: NVVPXBSOUBMECG-UHFFFAOYSA-N.
| Molecular formula | C8H8ClN3 |
|---|---|
| Molecular weight | 181.62 g/mol |
| IUPAC name | 4-chloro-5,6-dimethyl-7H-pyrrolo[2,3-d]pyrimidine |
| InChIKey | NVVPXBSOUBMECG-UHFFFAOYSA-N |
| SMILES | CC1=C(NC2=C1C(=NC=N2)Cl)C |
Computed by PubChem (NCBI)