cas: 82703-38-6 — see every product listed under this CAS number, including other names
4-Chloro-5,6-dimethyl-7H-pyrrolo[2,3-d]pyrimidine, 98%, 98% (CAS 82703-38-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11G0VQ-100mg |
| cas | 82703-38-6 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1168.40 Pln | |
| Chemat | 250mg | 1946.00 Pln | |
| Chemat | 1g | 4907.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-chloro-5,6-dimethyl-7H-pyrrolo[2,3-d]pyrimidine (CAS 82703-38-6) is a chemical compound with the molecular formula C8H8ClN3 and a molecular weight of 181.62 g/mol. IUPAC name: 4-chloro-5,6-dimethyl-7H-pyrrolo[2,3-d]pyrimidine. InChIKey: NVVPXBSOUBMECG-UHFFFAOYSA-N.
| Molecular formula | C8H8ClN3 |
|---|---|
| Molecular weight | 181.62 g/mol |
| IUPAC name | 4-chloro-5,6-dimethyl-7H-pyrrolo[2,3-d]pyrimidine |
| InChIKey | NVVPXBSOUBMECG-UHFFFAOYSA-N |
| SMILES | CC1=C(NC2=C1C(=NC=N2)Cl)C |
Computed by PubChem (NCBI)