Products 82703-38-6
CAS 82703-38-6 appears in our catalog under these names: 4-Chloro-5,6-dimethyl-7h-pyrrolo[2,3-d]pyrimidine, 95%, 4–Chloro–5，6–diMethyl–7H–pyrrolo(2，3–d)pyriMidine, 4-Chloro-5,6-dimethyl-7H-pyrrolo(2,3-D)pyrimidine, 4-Chloro-5,6-dimethyl-7H-pyrrolo[2,3-d]pyrimidine, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat. Available pack sizes: 250mg, 1g, 50mg, 0,5g, 100mg.
4-chloro-5,6-dimethyl-7H-pyrrolo[2,3-d]pyrimidine (CAS 82703-38-6) is a chemical compound with the molecular formula C8H8ClN3 and a molecular weight of 181.62 g/mol. IUPAC name: 4-chloro-5,6-dimethyl-7H-pyrrolo[2,3-d]pyrimidine. InChIKey: NVVPXBSOUBMECG-UHFFFAOYSA-N.
| Molecular formula | C8H8ClN3 |
|---|---|
| Molecular weight | 181.62 g/mol |
| IUPAC name | 4-chloro-5,6-dimethyl-7H-pyrrolo[2,3-d]pyrimidine |
| InChIKey | NVVPXBSOUBMECG-UHFFFAOYSA-N |
| SMILES | CC1=C(NC2=C1C(=NC=N2)Cl)C |
Computed by PubChem (NCBI)