cas: 52448-14-3 — see every product listed under this CAS number, including other names
4-CHLORO-L-TRYPTOPHAN, 98% (CAS 52448-14-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F819275-100MG |
| cas | 52448-14-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 279.09 Pln | |
| Fluorochem | 250mg | 372.80 Pln | |
| Fluorochem | 1g | 846.59 Pln | |
| Fluorochem | 5g | 2950.02 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(2S)-2-amino-3-(4-chloro-1H-indol-3-yl)propanoic acid (CAS 52448-14-3) is a chemical compound with the molecular formula C11H11ClN2O2 and a molecular weight of 238.67 g/mol. IUPAC name: (2S)-2-amino-3-(4-chloro-1H-indol-3-yl)propanoic acid. InChIKey: NRTHKYABOMUPSC-QMMMGPOBSA-N.
| Molecular formula | C11H11ClN2O2 |
|---|---|
| Molecular weight | 238.67 g/mol |
| IUPAC name | (2S)-2-amino-3-(4-chloro-1H-indol-3-yl)propanoic acid |
| InChIKey | NRTHKYABOMUPSC-QMMMGPOBSA-N |
| SMILES | C1=CC2=C(C(=C1)Cl)C(=CN2)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)