cas: 1951441-48-7 — see every product listed under this CAS number, including other names
4-CHloropyrido(3,2-d)pyrimidine hcl, 95% (CAS 1951441-48-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A986557-1g |
| cas | 1951441-48-7 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 8363.74 Pln | |
| AmBeed | 5g | 14880.25 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
4-chloropyrido[3,2-d]pyrimidine;hydrochloride (CAS 1951441-48-7) is a chemical compound with the molecular formula C7H5Cl2N3 and a molecular weight of 202.04 g/mol. IUPAC name: 4-chloropyrido[3,2-d]pyrimidine;hydrochloride. InChIKey: KMFGZNYFTNEMQK-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2N3 |
|---|---|
| Molecular weight | 202.04 g/mol |
| IUPAC name | 4-chloropyrido[3,2-d]pyrimidine;hydrochloride |
| InChIKey | KMFGZNYFTNEMQK-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=NC=N2)Cl)N=C1.Cl |
Computed by PubChem (NCBI)