cas: 56131-49-8 — see every product listed under this CAS number, including other names
4-CYANOPHENYL 4-PROPYL-BENZOATE, 98% (CAS 56131-49-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F300791-100MG |
| cas | 56131-49-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 122.89 Pln | |
| Fluorochem | 250mg | 164.54 Pln | |
| Fluorochem | 1g | 294.71 Pln | |
| Fluorochem | 5g | 737.26 Pln | |
| Fluorochem | 10g | 1294.35 Pln | |
| Fluorochem | 25g | 2252.35 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(4-cyanophenyl) 4-propylbenzoate (CAS 56131-49-8) is a chemical compound with the molecular formula C17H15NO2 and a molecular weight of 265.31 g/mol. IUPAC name: (4-cyanophenyl) 4-propylbenzoate. InChIKey: NCTWNVKZQMMLIV-UHFFFAOYSA-N.
| Molecular formula | C17H15NO2 |
|---|---|
| Molecular weight | 265.31 g/mol |
| IUPAC name | (4-cyanophenyl) 4-propylbenzoate |
| InChIKey | NCTWNVKZQMMLIV-UHFFFAOYSA-N |
| SMILES | CCCC1=CC=C(C=C1)C(=O)OC2=CC=C(C=C2)C#N |
Computed by PubChem (NCBI)