CAS 100896-08-0 is the registry number for 3-(9-Anthryl)-l-alanine, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 250mg, 1g.
(2S)-2-amino-3-anthracen-9-ylpropanoic acid (CAS 100896-08-0) is a chemical compound with the molecular formula C17H15NO2 and a molecular weight of 265.31 g/mol. IUPAC name: (2S)-2-amino-3-anthracen-9-ylpropanoic acid. InChIKey: MRVJUNXMEDRMRO-INIZCTEOSA-N.
| Molecular formula | C17H15NO2 |
|---|---|
| Molecular weight | 265.31 g/mol |
| IUPAC name | (2S)-2-amino-3-anthracen-9-ylpropanoic acid |
| InChIKey | MRVJUNXMEDRMRO-INIZCTEOSA-N |
| SMILES | C1=CC=C2C(=C1)C=C3C=CC=CC3=C2C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)