CAS 26211-90-5 appears in our catalog under these names: 2-Methyl-3-(4'-methoxybenzoyl)indole, 97%, 2-Methyl-3-(4'-methoxybenzoyl)indole. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 250mg, 1000mg, 2000mg, 5000mg.
(4-methoxyphenyl)-(2-methyl-1H-indol-3-yl)methanone (CAS 26211-90-5) is a chemical compound with the molecular formula C17H15NO2 and a molecular weight of 265.31 g/mol. IUPAC name: (4-methoxyphenyl)-(2-methyl-1H-indol-3-yl)methanone. InChIKey: QZVJIIKWCINHPD-UHFFFAOYSA-N.
| Molecular formula | C17H15NO2 |
|---|---|
| Molecular weight | 265.31 g/mol |
| IUPAC name | (4-methoxyphenyl)-(2-methyl-1H-indol-3-yl)methanone |
| InChIKey | QZVJIIKWCINHPD-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=CC=CC=C2N1)C(=O)C3=CC=C(C=C3)OC |
Computed by PubChem (NCBI)