Products 1036569-09-1

CAS 1036569-09-1 is the registry number for 1-(2-Phenylethyl)-1h-indole-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

1-(2-phenylethyl)indole-2-carboxylic acid (CAS 1036569-09-1) is a chemical compound with the molecular formula C17H15NO2 and a molecular weight of 265.31 g/mol. IUPAC name: 1-(2-phenylethyl)indole-2-carboxylic acid. InChIKey: UFIBJORPDOFOAW-UHFFFAOYSA-N.

Identity
Molecular formulaC17H15NO2
Molecular weight265.31 g/mol
IUPAC name1-(2-phenylethyl)indole-2-carboxylic acid
InChIKeyUFIBJORPDOFOAW-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)CCN2C3=CC=CC=C3C=C2C(=O)O

Computed by PubChem (NCBI)