CAS 943117-12-2 appears in our catalog under these names: 1-(4-Methylbenzyl)-1h-indole-3-carboxylic acid, 90%, 1-(p-Tolylmethyl)indole-3-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 2,5g, 250mg.
1-[(4-methylphenyl)methyl]indole-3-carboxylic acid (CAS 943117-12-2) is a chemical compound with the molecular formula C17H15NO2 and a molecular weight of 265.31 g/mol. IUPAC name: 1-[(4-methylphenyl)methyl]indole-3-carboxylic acid. InChIKey: WCENYNLOOHOOMC-UHFFFAOYSA-N.
| Molecular formula | C17H15NO2 |
|---|---|
| Molecular weight | 265.31 g/mol |
| IUPAC name | 1-[(4-methylphenyl)methyl]indole-3-carboxylic acid |
| InChIKey | WCENYNLOOHOOMC-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)CN2C=C(C3=CC=CC=C32)C(=O)O |
Computed by PubChem (NCBI)