CAS 136496-72-5 appears in our catalog under these names: 4-Carboxy-3-chlorophenylboronic Acid (contains varying amounts of Anhydride), 4-Carboxy-3-chlorophenylboronic acid, 98%, 98%, 3-Chloro-4-carboxyphenylboronic acid, 95%, 4-Carboxy-3-chlorophenylboronic acid, 98%. Offered by: TCI, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 250mg, 25g, 10g, 100g.
4-borono-2-chlorobenzoic acid (CAS 136496-72-5) is a chemical compound with the molecular formula C7H6BClO4 and a molecular weight of 200.38 g/mol. IUPAC name: 4-borono-2-chlorobenzoic acid. InChIKey: QFAFGWXQNDYXPZ-UHFFFAOYSA-N.
| Molecular formula | C7H6BClO4 |
|---|---|
| Molecular weight | 200.38 g/mol |
| IUPAC name | 4-borono-2-chlorobenzoic acid |
| InChIKey | QFAFGWXQNDYXPZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C(=O)O)Cl)(O)O |
Computed by PubChem (NCBI)