Products 25543-68-4
CAS 25543-68-4 appears in our catalog under these names: 1,5-Dihydroxynaphthalene-2,6-dicarboxylic Acid, 1,5-Dihydroxynaphthalene-2,6-dicarboxylic acid 95+%. Offered by: TRC, Ambeed. Available pack sizes: 500mg, 50mg, 100mg, 250mg, 1g.
1,5-dihydroxynaphthalene-2,6-dicarboxylic acid (CAS 25543-68-4) is a chemical compound with the molecular formula C12H8O6 and a molecular weight of 248.19 g/mol. IUPAC name: 1,5-dihydroxynaphthalene-2,6-dicarboxylic acid. InChIKey: FZUDMFCCNVDITF-UHFFFAOYSA-N.
| Molecular formula | C12H8O6 |
|---|---|
| Molecular weight | 248.19 g/mol |
| IUPAC name | 1,5-dihydroxynaphthalene-2,6-dicarboxylic acid |
| InChIKey | FZUDMFCCNVDITF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1C(=C(C=C2)C(=O)O)O)O)C(=O)O |
Computed by PubChem (NCBI)