Products 54755-93-0
CAS 54755-93-0 is the registry number for SHP2-IN-5. Offered by: MedChemExpress. Available pack sizes: Get quote.
3,4,5-trihydroxy-6-oxobenzo[7]annulene-8-carboxylic acid (CAS 54755-93-0) is a chemical compound with the molecular formula C12H8O6 and a molecular weight of 248.19 g/mol. IUPAC name: 3,4,5-trihydroxy-6-oxobenzo[7]annulene-8-carboxylic acid. InChIKey: XCSLJQFPTAZKDV-UHFFFAOYSA-N.
| Molecular formula | C12H8O6 |
|---|---|
| Molecular weight | 248.19 g/mol |
| IUPAC name | 3,4,5-trihydroxy-6-oxobenzo[7]annulene-8-carboxylic acid |
| InChIKey | XCSLJQFPTAZKDV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C(C(=O)C=C(C=C21)C(=O)O)O)O)O |
Computed by PubChem (NCBI)