CAS 1263212-96-9 is the registry number for 5-(1,3-Dioxaindan-5-yloxy)furan-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-(1,3-benzodioxol-5-yloxy)furan-2-carboxylic acid (CAS 1263212-96-9) is a chemical compound with the molecular formula C12H8O6 and a molecular weight of 248.19 g/mol. IUPAC name: 5-(1,3-benzodioxol-5-yloxy)furan-2-carboxylic acid. InChIKey: KBHAVTJDHNRPHQ-UHFFFAOYSA-N.
| Molecular formula | C12H8O6 |
|---|---|
| Molecular weight | 248.19 g/mol |
| IUPAC name | 5-(1,3-benzodioxol-5-yloxy)furan-2-carboxylic acid |
| InChIKey | KBHAVTJDHNRPHQ-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)OC3=CC=C(O3)C(=O)O |
Computed by PubChem (NCBI)