Products 1263212-96-9

CAS 1263212-96-9 is the registry number for 5-(1,3-Dioxaindan-5-yloxy)furan-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

5-(1,3-benzodioxol-5-yloxy)furan-2-carboxylic acid (CAS 1263212-96-9) is a chemical compound with the molecular formula C12H8O6 and a molecular weight of 248.19 g/mol. IUPAC name: 5-(1,3-benzodioxol-5-yloxy)furan-2-carboxylic acid. InChIKey: KBHAVTJDHNRPHQ-UHFFFAOYSA-N.

Identity
Molecular formulaC12H8O6
Molecular weight248.19 g/mol
IUPAC name5-(1,3-benzodioxol-5-yloxy)furan-2-carboxylic acid
InChIKeyKBHAVTJDHNRPHQ-UHFFFAOYSA-N
SMILESC1OC2=C(O1)C=C(C=C2)OC3=CC=C(O3)C(=O)O

Computed by PubChem (NCBI)