4-Carboxyphenylboronic acid, 98%, 98%
cas: 14047-29-1 — see every product listed under this CAS number, including other names
4-Carboxyphenylboronic acid, 98%, 98% (CAS 14047-29-1) is a chemical reagent available from Chemat. Available pack sizes: 50g, 250g, 1kg, 5kg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112CIJ-50g |
| cas | 14047-29-1 |
| size | 50g |
| availability | 10000g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 50g | 126.80 Pln | |
| Chemat | 250g | 366.80 Pln | |
| Chemat | 1kg | 1355.60 Pln | |
| Chemat | 5kg | 6000.00 Pln | |
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 83.60 Pln | |
| Chemat | 25g | 93.20 Pln | |
| Chemat | 100g | 184.40 Pln | |
| Chemat | 500g | 739.20 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-boronobenzoic acid (CAS 14047-29-1) is a chemical compound with the molecular formula C7H7BO4 and a molecular weight of 165.94 g/mol. IUPAC name: 4-boronobenzoic acid. InChIKey: SIAVMDKGVRXFAX-UHFFFAOYSA-N.
| Molecular formula | C7H7BO4 |
|---|---|
| Molecular weight | 165.94 g/mol |
| IUPAC name | 4-boronobenzoic acid |
| InChIKey | SIAVMDKGVRXFAX-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(=O)O)(O)O |
Computed by PubChem (NCBI)