Products 94839-07-3
CAS 94839-07-3 appears in our catalog under these names: 3,4–(Methylenedioxy)phenylboronic acid, 3,4-(Methylenedioxy)benzeneboronic acid, 98% , 3,4-(Methylenedioxy)phenylboronic Acid (contains varying amounts of Anhydride), 3,4-Methylenedioxyphenylboronic acid, 98%, 1,3-Benzodioxole-5-boronic acid 98%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Thermo Scientific (Acros), Ambeed. Available pack sizes: 25g, 1g, 5g, 250mg, 10g, 100g, 500g.
1,3-benzodioxol-5-ylboronic acid (CAS 94839-07-3) is a chemical compound with the molecular formula C7H7BO4 and a molecular weight of 165.94 g/mol. IUPAC name: 1,3-benzodioxol-5-ylboronic acid. InChIKey: CMHPUBKZZPSUIQ-UHFFFAOYSA-N.
| Molecular formula | C7H7BO4 |
|---|---|
| Molecular weight | 165.94 g/mol |
| IUPAC name | 1,3-benzodioxol-5-ylboronic acid |
| InChIKey | CMHPUBKZZPSUIQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)OCO2)(O)O |
Computed by PubChem (NCBI)
Synonyms:
Benzo[d][1,3]dioxol-5-ylboronic acid, 3,4-(Methylenedioxy)phenylboronic acid, 1,3-benzodioxol-5-ylboronic acid, 3,4-(Methylenedioxy)benzeneboronic acid, 3,4-Methylenedioxyphenyl boronic acid, 1,3-Benzodioxole-5-boronic acid, 3,4-Methylenedioxybenzeneboronic acid, 4-methylenedioxyphenylboronic acid, 3,4-methylenedioxyphenyl-boronic acid, 5-benzo[d][1,3]dioxole boronic acid