Products 2121513-62-8
CAS 2121513-62-8 appears in our catalog under these names: 5-Formyl-2-hydroxyphenylboronic acid, 95%, (5-Formyl-2-hydroxyphenyl)boronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
(5-formyl-2-hydroxyphenyl)boronic acid (CAS 2121513-62-8) is a chemical compound with the molecular formula C7H7BO4 and a molecular weight of 165.94 g/mol. IUPAC name: (5-formyl-2-hydroxyphenyl)boronic acid. InChIKey: UZWDXMNHBAFRLN-UHFFFAOYSA-N.
| Molecular formula | C7H7BO4 |
|---|---|
| Molecular weight | 165.94 g/mol |
| IUPAC name | (5-formyl-2-hydroxyphenyl)boronic acid |
| InChIKey | UZWDXMNHBAFRLN-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)C=O)O)(O)O |
Computed by PubChem (NCBI)