Products 1228829-30-8
CAS 1228829-30-8 appears in our catalog under these names: 4-Formyl-3-hydroxyphenylboronic acid, 98%, (4-Formyl-3-hydroxyphenyl)boronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
(4-formyl-3-hydroxyphenyl)boronic acid (CAS 1228829-30-8) is a chemical compound with the molecular formula C7H7BO4 and a molecular weight of 165.94 g/mol. IUPAC name: (4-formyl-3-hydroxyphenyl)boronic acid. InChIKey: SNJFGZSXIIEXHA-UHFFFAOYSA-N.
| Molecular formula | C7H7BO4 |
|---|---|
| Molecular weight | 165.94 g/mol |
| IUPAC name | (4-formyl-3-hydroxyphenyl)boronic acid |
| InChIKey | SNJFGZSXIIEXHA-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C=O)O)(O)O |
Computed by PubChem (NCBI)